| Name | Pyruvic acid, potassium salt |
| Synonyms | EGHYT PYRUVATE Einecs 223-978-2 POTASSIUM PYRUVATE Potassium pyruvate potassium 2-oxopropanoate potassiuM 2-oxopropanoate Pyruvic acid Potassium salt Pyruvic acid, potassium salt 2-Oxopropionic acid potassium salt Propanoic acid, 2-oxo-, potassium salt POTASSIUMPYRUVATE(PYRUVICACIDPOTASSIUM) |
| CAS | 4151-33-1 |
| EINECS | 223-978-2 |
| InChI | InChI=1/C3H4O3.K/c1-2(4)3(5)6;/h1H3,(H,5,6);/q;+1/p-1 |
| Molecular Formula | C3H3KO3 |
| Molar Mass | 126.15 |
| Melting Point | >175°C (dec.) |
| Boling Point | 165°C at 760 mmHg |
| Flash Point | 54.3°C |
| Solubility | Methanol (Slightly), Water (Slightly) |
| Vapor Presure | 0.968mmHg at 25°C |
| Appearance | Solid |
| Color | White to Off-White |
| Storage Condition | Inert atmosphere,Room Temperature |
| Stability | Hygroscopic |
| Use | Used as raw materials for medicine and food additives |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | used as raw materials and food additives for medicine |